CAS 1803583-80-3 appears in our catalog under these names: 3-(5-Amino-2-methylphenyl)imidazolidine-2,4-dione, 3-(5-Amino-2-methylphenyl)imidazolidine-2,4-dione, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.
3-(5-amino-2-methylphenyl)imidazolidine-2,4-dione (CAS 1803583-80-3) is a chemical compound with the molecular formula C10H11N3O2 and a molecular weight of 205.21 g/mol. IUPAC name: 3-(5-amino-2-methylphenyl)imidazolidine-2,4-dione. InChIKey: QVUCIZYMYKEDCH-UHFFFAOYSA-N.
| Molecular formula | C10H11N3O2 |
|---|---|
| Molecular weight | 205.21 g/mol |
| IUPAC name | 3-(5-amino-2-methylphenyl)imidazolidine-2,4-dione |
| InChIKey | QVUCIZYMYKEDCH-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)N)N2C(=O)CNC2=O |
Computed by PubChem (NCBI)