Products 1803583-95-0
CAS 1803583-95-0 appears in our catalog under these names: 2-Amino-5-fluoro-n,n-dimethylbenzamide hydrochloride, 95%, 2-Amino-5-fluoro-N,N-dimethylbenzamide hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 0,5g.
2-amino-5-fluoro-N,N-dimethylbenzamide;hydrochloride (CAS 1803583-95-0) is a chemical compound with the molecular formula C9H12ClFN2O and a molecular weight of 218.65 g/mol. IUPAC name: 2-amino-5-fluoro-N,N-dimethylbenzamide;hydrochloride. InChIKey: WPDFIXCQNQIJGQ-UHFFFAOYSA-N.
| Molecular formula | C9H12ClFN2O |
|---|---|
| Molecular weight | 218.65 g/mol |
| IUPAC name | 2-amino-5-fluoro-N,N-dimethylbenzamide;hydrochloride |
| InChIKey | WPDFIXCQNQIJGQ-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=C(C=CC(=C1)F)N.Cl |
Computed by PubChem (NCBI)