Products 2924891-23-4
CAS 2924891-23-4 is the registry number for 3-(Chloromethyl)-4-fluoro-1-(tetrahydro-2H-pyran-2-yl)-1H-pyrazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(chloromethyl)-4-fluoro-1-(oxan-2-yl)pyrazole (CAS 2924891-23-4) is a chemical compound with the molecular formula C9H12ClFN2O and a molecular weight of 218.65 g/mol. IUPAC name: 3-(chloromethyl)-4-fluoro-1-(oxan-2-yl)pyrazole. InChIKey: GUYJJXCGYNUHJG-UHFFFAOYSA-N.
| Molecular formula | C9H12ClFN2O |
|---|---|
| Molecular weight | 218.65 g/mol |
| IUPAC name | 3-(chloromethyl)-4-fluoro-1-(oxan-2-yl)pyrazole |
| InChIKey | GUYJJXCGYNUHJG-UHFFFAOYSA-N |
| SMILES | C1CCOC(C1)N2C=C(C(=N2)CCl)F |
Computed by PubChem (NCBI)