Products 1803586-31-3

CAS 1803586-31-3 appears in our catalog under these names: Dimethyl-1,3-thiazole-4-carboxylic acid hydrochloride, 95%, 2,5-Dimethylthiazole-4-carboxylic acid hydrochloride, 95%, Dimethyl-1,3-thiazole-4-carboxylic acid hydrochloride, 2,5-Dimethylthiazole-4-carboxylic acid hydrochloride 95%, DIMETHYL-1,3-THIAZOLE-4-CARBOXYLIC ACID HYDROCHLORIDE, 95%, 95%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.

Structural formula: {0} (CAS {1})

2,5-dimethyl-1,3-thiazole-4-carboxylic acid;hydrochloride (CAS 1803586-31-3) is a chemical compound with the molecular formula C6H8ClNO2S and a molecular weight of 193.65 g/mol. IUPAC name: 2,5-dimethyl-1,3-thiazole-4-carboxylic acid;hydrochloride. InChIKey: ASFFKQYQZGIQBX-UHFFFAOYSA-N.

Identity
Molecular formulaC6H8ClNO2S
Molecular weight193.65 g/mol
IUPAC name2,5-dimethyl-1,3-thiazole-4-carboxylic acid;hydrochloride
InChIKeyASFFKQYQZGIQBX-UHFFFAOYSA-N
SMILESCC1=C(N=C(S1)C)C(=O)O.Cl

Computed by PubChem (NCBI)