Products 90198-37-1

CAS 90198-37-1 is the registry number for Ethyl 1,3-thiazole-5-carboxylate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

Ethyl 1,3-thiazole-5-carboxylate;hydrochloride (CAS 90198-37-1) is a chemical compound with the molecular formula C6H8ClNO2S and a molecular weight of 193.65 g/mol. IUPAC name: ethyl 1,3-thiazole-5-carboxylate;hydrochloride. InChIKey: KJKXOSGOZZKRLU-UHFFFAOYSA-N.

Identity
Molecular formulaC6H8ClNO2S
Molecular weight193.65 g/mol
IUPAC nameethyl 1,3-thiazole-5-carboxylate;hydrochloride
InChIKeyKJKXOSGOZZKRLU-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CN=CS1.Cl

Computed by PubChem (NCBI)