CAS 1803586-66-4 is the registry number for 2-((4-Chlorophenyl)methyl)-1H-imidazole-4-carboxylic acid hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
2-[(4-chlorophenyl)methyl]-1H-imidazole-5-carboxylic acid;hydrochloride (CAS 1803586-66-4) is a chemical compound with the molecular formula C11H10Cl2N2O2 and a molecular weight of 273.11 g/mol. IUPAC name: 2-[(4-chlorophenyl)methyl]-1H-imidazole-5-carboxylic acid;hydrochloride. InChIKey: SZVNXLTYSUEGQC-UHFFFAOYSA-N.
| Molecular formula | C11H10Cl2N2O2 |
|---|---|
| Molecular weight | 273.11 g/mol |
| IUPAC name | 2-[(4-chlorophenyl)methyl]-1H-imidazole-5-carboxylic acid;hydrochloride |
| InChIKey | SZVNXLTYSUEGQC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC2=NC=C(N2)C(=O)O)Cl.Cl |
Computed by PubChem (NCBI)