Products 2447-24-7
CAS 2447-24-7 appears in our catalog under these names: 3-(2-Aminoethyl)-5,7-dichloro-1h-indole-2-carboxylic acid hydrochloride, 95%, 3-(2-Aminoethyl)-5,7-dichloro-1H-indole-2-carboxylic acid hydrochloride, >95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 250mg, 1g, 100mg.
3-(2-aminoethyl)-5,7-dichloro-1H-indole-2-carboxylic acid (CAS 2447-24-7) is a chemical compound with the molecular formula C11H10Cl2N2O2 and a molecular weight of 273.11 g/mol. IUPAC name: 3-(2-aminoethyl)-5,7-dichloro-1H-indole-2-carboxylic acid. InChIKey: GBECJVKCLZDMQS-UHFFFAOYSA-N.
| Molecular formula | C11H10Cl2N2O2 |
|---|---|
| Molecular weight | 273.11 g/mol |
| IUPAC name | 3-(2-aminoethyl)-5,7-dichloro-1H-indole-2-carboxylic acid |
| InChIKey | GBECJVKCLZDMQS-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1C(=C(N2)C(=O)O)CCN)Cl)Cl |
Computed by PubChem (NCBI)