Products 1803586-72-2

CAS 1803586-72-2 is the registry number for 4-(Difluoromethyl)-2-phenyl-1,3-oxazole-5-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

4-(difluoromethyl)-2-phenyl-1,3-oxazole-5-carboxylic acid (CAS 1803586-72-2) is a chemical compound with the molecular formula C11H7F2NO3 and a molecular weight of 239.17 g/mol. IUPAC name: 4-(difluoromethyl)-2-phenyl-1,3-oxazole-5-carboxylic acid. InChIKey: YXECJUUYOZSIPM-UHFFFAOYSA-N.

Identity
Molecular formulaC11H7F2NO3
Molecular weight239.17 g/mol
IUPAC name4-(difluoromethyl)-2-phenyl-1,3-oxazole-5-carboxylic acid
InChIKeyYXECJUUYOZSIPM-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C2=NC(=C(O2)C(=O)O)C(F)F

Computed by PubChem (NCBI)