CAS 1803586-72-2 is the registry number for 4-(Difluoromethyl)-2-phenyl-1,3-oxazole-5-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-(difluoromethyl)-2-phenyl-1,3-oxazole-5-carboxylic acid (CAS 1803586-72-2) is a chemical compound with the molecular formula C11H7F2NO3 and a molecular weight of 239.17 g/mol. IUPAC name: 4-(difluoromethyl)-2-phenyl-1,3-oxazole-5-carboxylic acid. InChIKey: YXECJUUYOZSIPM-UHFFFAOYSA-N.
| Molecular formula | C11H7F2NO3 |
|---|---|
| Molecular weight | 239.17 g/mol |
| IUPAC name | 4-(difluoromethyl)-2-phenyl-1,3-oxazole-5-carboxylic acid |
| InChIKey | YXECJUUYOZSIPM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=C(O2)C(=O)O)C(F)F |
Computed by PubChem (NCBI)