CAS 1803587-01-0 is the registry number for 3-(3-Bromo-5-methylphenyl)-2-cyanopropanamide, 95%. Offered by: AmBeed. Available pack sizes: 1g.
3-(3-bromo-5-methylphenyl)-2-cyanopropanamide (CAS 1803587-01-0) is a chemical compound with the molecular formula C11H11BrN2O and a molecular weight of 267.12 g/mol. IUPAC name: 3-(3-bromo-5-methylphenyl)-2-cyanopropanamide. InChIKey: QHGOZGQQTQNBTK-UHFFFAOYSA-N.
| Molecular formula | C11H11BrN2O |
|---|---|
| Molecular weight | 267.12 g/mol |
| IUPAC name | 3-(3-bromo-5-methylphenyl)-2-cyanopropanamide |
| InChIKey | QHGOZGQQTQNBTK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)Br)CC(C#N)C(=O)N |
Computed by PubChem (NCBI)