CAS 1803587-16-7 is the registry number for {4-(3-(Pyridin-4-yl)-1,2,4-oxadiazol-5-yl)phenyl}methanamine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
[4-(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)phenyl]methanamine;hydrochloride (CAS 1803587-16-7) is a chemical compound with the molecular formula C14H13ClN4O and a molecular weight of 288.73 g/mol. IUPAC name: [4-(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)phenyl]methanamine;hydrochloride. InChIKey: LOYBGYLLZDWXBB-UHFFFAOYSA-N.
| Molecular formula | C14H13ClN4O |
|---|---|
| Molecular weight | 288.73 g/mol |
| IUPAC name | [4-(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)phenyl]methanamine;hydrochloride |
| InChIKey | LOYBGYLLZDWXBB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN)C2=NC(=NO2)C3=CC=NC=C3.Cl |
Computed by PubChem (NCBI)