CAS 356085-76-2 is the registry number for 2-(3-Chloro-4-methoxyphenyl)-6-methyl-2h-1,2,3-benzotriazol-5-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-(3-chloro-4-methoxyphenyl)-6-methylbenzotriazol-5-amine (CAS 356085-76-2) is a chemical compound with the molecular formula C14H13ClN4O and a molecular weight of 288.73 g/mol. IUPAC name: 2-(3-chloro-4-methoxyphenyl)-6-methylbenzotriazol-5-amine. InChIKey: BGNDWNNNEAFUTP-UHFFFAOYSA-N.
| Molecular formula | C14H13ClN4O |
|---|---|
| Molecular weight | 288.73 g/mol |
| IUPAC name | 2-(3-chloro-4-methoxyphenyl)-6-methylbenzotriazol-5-amine |
| InChIKey | BGNDWNNNEAFUTP-UHFFFAOYSA-N |
| SMILES | CC1=CC2=NN(N=C2C=C1N)C3=CC(=C(C=C3)OC)Cl |
Computed by PubChem (NCBI)