Products 1803587-39-4

CAS 1803587-39-4 appears in our catalog under these names: 3-methoxyazetidine-1-sulfonyl chloride, 97%, 3-Methoxyazetidine-1-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 0,5g, 50mg.

3-methoxyazetidine-1-sulfonyl chloride (CAS 1803587-39-4) is a chemical compound with the molecular formula C4H8ClNO3S and a molecular weight of 185.63 g/mol. IUPAC name: 3-methoxyazetidine-1-sulfonyl chloride. InChIKey: HKVVYJYTPLONNK-UHFFFAOYSA-N.

Identity
Molecular formulaC4H8ClNO3S
Molecular weight185.63 g/mol
IUPAC name3-methoxyazetidine-1-sulfonyl chloride
InChIKeyHKVVYJYTPLONNK-UHFFFAOYSA-N
SMILESCOC1CN(C1)S(=O)(=O)Cl

Computed by PubChem (NCBI)