Products 1828-66-6

CAS 1828-66-6 appears in our catalog under these names: Morpholine-4-sulfonyl chloride 95%, Morpholine-4-sulfonyl chloride, 95%, 95%, Morpholine-4-sulfonyl chloride, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g, 10g, 250mg, 100g.

Structural formula: {0} (CAS {1})

Morpholine-4-sulfonyl chloride (CAS 1828-66-6) is a chemical compound with the molecular formula C4H8ClNO3S and a molecular weight of 185.63 g/mol. IUPAC name: morpholine-4-sulfonyl chloride. InChIKey: KXIBCCFSAMRWIC-UHFFFAOYSA-N.

Identity
Molecular formulaC4H8ClNO3S
Molecular weight185.63 g/mol
IUPAC namemorpholine-4-sulfonyl chloride
InChIKeyKXIBCCFSAMRWIC-UHFFFAOYSA-N
SMILESC1COCCN1S(=O)(=O)Cl

Computed by PubChem (NCBI)