CAS 1803588-04-6 is the registry number for 2-(2-(1,3-Dioxo-2,3-dihydro-1H-isoindol-2-yl)ethoxy)ethane-1-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-[2-(1,3-dioxoisoindol-2-yl)ethoxy]ethanesulfonyl chloride (CAS 1803588-04-6) is a chemical compound with the molecular formula C12H12ClNO5S and a molecular weight of 317.75 g/mol. IUPAC name: 2-[2-(1,3-dioxoisoindol-2-yl)ethoxy]ethanesulfonyl chloride. InChIKey: GDSNVUOBVGDVHB-UHFFFAOYSA-N.
| Molecular formula | C12H12ClNO5S |
|---|---|
| Molecular weight | 317.75 g/mol |
| IUPAC name | 2-[2-(1,3-dioxoisoindol-2-yl)ethoxy]ethanesulfonyl chloride |
| InChIKey | GDSNVUOBVGDVHB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)CCOCCS(=O)(=O)Cl |
Computed by PubChem (NCBI)