CAS 927999-81-3 is the registry number for 5-(2,6-Dioxopiperidin-1-yl)-2-methoxybenzenesulfonyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
5-(2,6-dioxopiperidin-1-yl)-2-methoxybenzenesulfonyl chloride (CAS 927999-81-3) is a chemical compound with the molecular formula C12H12ClNO5S and a molecular weight of 317.75 g/mol. IUPAC name: 5-(2,6-dioxopiperidin-1-yl)-2-methoxybenzenesulfonyl chloride. InChIKey: RXPCPJFYLBFCRV-UHFFFAOYSA-N.
| Molecular formula | C12H12ClNO5S |
|---|---|
| Molecular weight | 317.75 g/mol |
| IUPAC name | 5-(2,6-dioxopiperidin-1-yl)-2-methoxybenzenesulfonyl chloride |
| InChIKey | RXPCPJFYLBFCRV-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)N2C(=O)CCCC2=O)S(=O)(=O)Cl |
Computed by PubChem (NCBI)