CAS 1803589-60-7 is the registry number for 5-(Azidomethyl)-2-ethyl-4-methyl-1,3-oxazole. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-(azidomethyl)-2-ethyl-4-methyl-1,3-oxazole (CAS 1803589-60-7) is a chemical compound with the molecular formula C7H10N4O and a molecular weight of 166.18 g/mol. IUPAC name: 5-(azidomethyl)-2-ethyl-4-methyl-1,3-oxazole. InChIKey: VBVVANRGFWEIAB-UHFFFAOYSA-N.
| Molecular formula | C7H10N4O |
|---|---|
| Molecular weight | 166.18 g/mol |
| IUPAC name | 5-(azidomethyl)-2-ethyl-4-methyl-1,3-oxazole |
| InChIKey | VBVVANRGFWEIAB-UHFFFAOYSA-N |
| SMILES | CCC1=NC(=C(O1)CN=[N+]=[N-])C |
Computed by PubChem (NCBI)