CAS 1803592-71-3 appears in our catalog under these names: 4-(4-Amino-3-methoxyphenyl)-1lambda6-thiomorpholine-1,1-dione Hydrochloride, >95% (HPLC), 4-(4-Amino-3-methoxyphenyl)thiomorpholine 1,1-dioxide hydrochloride, 98%, 4-(1,1-Dioxo-1,4-thiazinan-4-yl)-2-methoxyaniline hydrochloride. Offered by: TRC, AmBeed, Biosynth. Available pack sizes: 250mg, 500mg, 50mg, 1g, 0,5g.
4-(1,1-dioxo-1,4-thiazinan-4-yl)-2-methoxyaniline;hydrochloride (CAS 1803592-71-3) is a chemical compound with the molecular formula C11H17ClN2O3S and a molecular weight of 292.78 g/mol. IUPAC name: 4-(1,1-dioxo-1,4-thiazinan-4-yl)-2-methoxyaniline;hydrochloride. InChIKey: JXWSJTQFAJFTNY-UHFFFAOYSA-N.
| Molecular formula | C11H17ClN2O3S |
|---|---|
| Molecular weight | 292.78 g/mol |
| IUPAC name | 4-(1,1-dioxo-1,4-thiazinan-4-yl)-2-methoxyaniline;hydrochloride |
| InChIKey | JXWSJTQFAJFTNY-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)N2CCS(=O)(=O)CC2)N.Cl |
Computed by PubChem (NCBI)