CAS 933989-50-5 is the registry number for 4-(Morpholine-4-sulfonyl)-benzylamine Hydrochloride. Offered by: TRC. Available pack sizes: 1g.
(4-morpholin-4-ylsulfonylphenyl)methanamine;hydrochloride (CAS 933989-50-5) is a chemical compound with the molecular formula C11H17ClN2O3S and a molecular weight of 292.78 g/mol. IUPAC name: (4-morpholin-4-ylsulfonylphenyl)methanamine;hydrochloride. InChIKey: VDVLIALYFAWJCR-UHFFFAOYSA-N.
| Molecular formula | C11H17ClN2O3S |
|---|---|
| Molecular weight | 292.78 g/mol |
| IUPAC name | (4-morpholin-4-ylsulfonylphenyl)methanamine;hydrochloride |
| InChIKey | VDVLIALYFAWJCR-UHFFFAOYSA-N |
| SMILES | C1COCCN1S(=O)(=O)C2=CC=C(C=C2)CN.Cl |
Computed by PubChem (NCBI)