CAS 1803595-01-8 appears in our catalog under these names: 1-(2,3-Dihydro-1H-isoindol-5-yl)propan-1-one hydrochloride, 95%, 1-(2,3-Dihydro-1H-isoindol-5-yl)propan-1-one hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1-(2,3-dihydro-1H-isoindol-5-yl)propan-1-one;hydrochloride (CAS 1803595-01-8) is a chemical compound with the molecular formula C11H14ClNO and a molecular weight of 211.69 g/mol. IUPAC name: 1-(2,3-dihydro-1H-isoindol-5-yl)propan-1-one;hydrochloride. InChIKey: NXHDQMDXDKEQMA-UHFFFAOYSA-N.
| Molecular formula | C11H14ClNO |
|---|---|
| Molecular weight | 211.69 g/mol |
| IUPAC name | 1-(2,3-dihydro-1H-isoindol-5-yl)propan-1-one;hydrochloride |
| InChIKey | NXHDQMDXDKEQMA-UHFFFAOYSA-N |
| SMILES | CCC(=O)C1=CC2=C(CNC2)C=C1.Cl |
Computed by PubChem (NCBI)