Products 1803596-07-7
CAS 1803596-07-7 is the registry number for 2-{1-(3-(Butan-2-yl)-1H-1,2,4-triazol-5-yl)ethyl}-2,3-dihydro-1H-isoindole-1,3-dione. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-[1-(3-butan-2-yl-1H-1,2,4-triazol-5-yl)ethyl]isoindole-1,3-dione (CAS 1803596-07-7) is a chemical compound with the molecular formula C16H18N4O2 and a molecular weight of 298.34 g/mol. IUPAC name: 2-[1-(3-butan-2-yl-1H-1,2,4-triazol-5-yl)ethyl]isoindole-1,3-dione. InChIKey: JLUHXGWRWKGDPE-UHFFFAOYSA-N.
| Molecular formula | C16H18N4O2 |
|---|---|
| Molecular weight | 298.34 g/mol |
| IUPAC name | 2-[1-(3-butan-2-yl-1H-1,2,4-triazol-5-yl)ethyl]isoindole-1,3-dione |
| InChIKey | JLUHXGWRWKGDPE-UHFFFAOYSA-N |
| SMILES | CCC(C)C1=NNC(=N1)C(C)N2C(=O)C3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)