Products 2251763-73-0
CAS 2251763-73-0 appears in our catalog under these names: 1,1'-(3,3'-Dimethyl-[1,1'-biphenyl]-4,4'-diyl)diurea, 95%, 95%, 1,1'-(3,3'-Dimethyl-[1,1'-biphenyl]-4,4'-diyl)diurea, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
[4-[4-(carbamoylamino)-3-methylphenyl]-2-methylphenyl]urea (CAS 2251763-73-0) is a chemical compound with the molecular formula C16H18N4O2 and a molecular weight of 298.34 g/mol. IUPAC name: [4-[4-(carbamoylamino)-3-methylphenyl]-2-methylphenyl]urea. InChIKey: NUUFEPKSJLDARI-UHFFFAOYSA-N.
| Molecular formula | C16H18N4O2 |
|---|---|
| Molecular weight | 298.34 g/mol |
| IUPAC name | [4-[4-(carbamoylamino)-3-methylphenyl]-2-methylphenyl]urea |
| InChIKey | NUUFEPKSJLDARI-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C2=CC(=C(C=C2)NC(=O)N)C)NC(=O)N |
Computed by PubChem (NCBI)