CAS 1803596-85-1 appears in our catalog under these names: {Bicyclo(2.2.2)octan-1-yl}methanesulfonyl chloride, BICYCLO[2.2.2]OCTAN-1-YLMETHANESULFONYL CHLORIDE, 97%, {bicyclo(2.2.2)octan-1-yl}methanesulfonyl chloride, 95%, Bicyclo[2.2.2]octane-1-methanesulfonyl chloride, 97%, 97%. Offered by: Biosynth, Fluorochem, AmBeed, Chemat. Available pack sizes: 0,5g, 50mg, 100mg, 250mg, 500mg, 1g, 5g.
1-bicyclo[2.2.2]octanylmethanesulfonyl chloride (CAS 1803596-85-1) is a chemical compound with the molecular formula C9H15ClO2S and a molecular weight of 222.73 g/mol. IUPAC name: 1-bicyclo[2.2.2]octanylmethanesulfonyl chloride. InChIKey: WFNMTXBKSKVCOM-UHFFFAOYSA-N.
| Molecular formula | C9H15ClO2S |
|---|---|
| Molecular weight | 222.73 g/mol |
| IUPAC name | 1-bicyclo[2.2.2]octanylmethanesulfonyl chloride |
| InChIKey | WFNMTXBKSKVCOM-UHFFFAOYSA-N |
| SMILES | C1CC2(CCC1CC2)CS(=O)(=O)Cl |
Computed by PubChem (NCBI)