Products 1862866-81-6

CAS 1862866-81-6 appears in our catalog under these names: {bicyclo(2.2.2)octan-2-yl}methanesulfonyl chloride, 95%, {Bicyclo(2.2.2)octan-2-yl}methanesulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2-bicyclo[2.2.2]octanylmethanesulfonyl chloride (CAS 1862866-81-6) is a chemical compound with the molecular formula C9H15ClO2S and a molecular weight of 222.73 g/mol. IUPAC name: 2-bicyclo[2.2.2]octanylmethanesulfonyl chloride. InChIKey: CIOAHLGCMMGWSA-UHFFFAOYSA-N.

Identity
Molecular formulaC9H15ClO2S
Molecular weight222.73 g/mol
IUPAC name2-bicyclo[2.2.2]octanylmethanesulfonyl chloride
InChIKeyCIOAHLGCMMGWSA-UHFFFAOYSA-N
SMILESC1CC2CCC1CC2CS(=O)(=O)Cl

Computed by PubChem (NCBI)