Products 1803597-04-7

CAS 1803597-04-7 is the registry number for Methyl 2-bromo-2-(1-methoxycyclobutyl)acetate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Methyl 2-bromo-2-(1-methoxycyclobutyl)acetate (CAS 1803597-04-7) is a chemical compound with the molecular formula C8H13BrO3 and a molecular weight of 237.09 g/mol. IUPAC name: methyl 2-bromo-2-(1-methoxycyclobutyl)acetate. InChIKey: QRPFVNKRLHTTHC-UHFFFAOYSA-N.

Identity
Molecular formulaC8H13BrO3
Molecular weight237.09 g/mol
IUPAC namemethyl 2-bromo-2-(1-methoxycyclobutyl)acetate
InChIKeyQRPFVNKRLHTTHC-UHFFFAOYSA-N
SMILESCOC(=O)C(C1(CCC1)OC)Br

Computed by PubChem (NCBI)