Products 74530-57-7

CAS 74530-57-7 is the registry number for tert-Butyl 4-bromo-3-oxobutanoate 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

Tert-butyl 4-bromo-3-oxobutanoate (CAS 74530-57-7) is a chemical compound with the molecular formula C8H13BrO3 and a molecular weight of 237.09 g/mol. IUPAC name: tert-butyl 4-bromo-3-oxobutanoate. InChIKey: ZDJPNMVEZZVIMC-UHFFFAOYSA-N.

Identity
Molecular formulaC8H13BrO3
Molecular weight237.09 g/mol
IUPAC nametert-butyl 4-bromo-3-oxobutanoate
InChIKeyZDJPNMVEZZVIMC-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)CC(=O)CBr

Computed by PubChem (NCBI)