CAS 1803599-82-7 appears in our catalog under these names: 3-(5-(Trifluoromethyl)-1,2,4-oxadiazol-3-yl)aniline hydrochloride, 95%, 3-(5-(Trifluoromethyl)-1,2,4-oxadiazol-3-yl)aniline hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]aniline;hydrochloride (CAS 1803599-82-7) is a chemical compound with the molecular formula C9H7ClF3N3O and a molecular weight of 265.62 g/mol. IUPAC name: 3-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]aniline;hydrochloride. InChIKey: DAPSDSGLQYWBQJ-UHFFFAOYSA-N.
| Molecular formula | C9H7ClF3N3O |
|---|---|
| Molecular weight | 265.62 g/mol |
| IUPAC name | 3-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]aniline;hydrochloride |
| InChIKey | DAPSDSGLQYWBQJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N)C2=NOC(=N2)C(F)(F)F.Cl |
Computed by PubChem (NCBI)