CAS 1823182-85-9 is the registry number for 1-(8-Chloro-6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl)ethanol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
1-[8-chloro-6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]ethanol (CAS 1823182-85-9) is a chemical compound with the molecular formula C9H7ClF3N3O and a molecular weight of 265.62 g/mol. IUPAC name: 1-[8-chloro-6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]ethanol. InChIKey: OEBLGOHDKAXGNZ-UHFFFAOYSA-N.
| Molecular formula | C9H7ClF3N3O |
|---|---|
| Molecular weight | 265.62 g/mol |
| IUPAC name | 1-[8-chloro-6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]ethanol |
| InChIKey | OEBLGOHDKAXGNZ-UHFFFAOYSA-N |
| SMILES | CC(C1=NN=C2N1C=C(C=C2Cl)C(F)(F)F)O |
Computed by PubChem (NCBI)