CAS 1803600-85-2 is the registry number for (4-Azidophenyl)methanamine Hydrochloride. Offered by: TRC. Available pack sizes: 100mg.
(4-azidophenyl)methanamine;hydrochloride (CAS 1803600-85-2) is a chemical compound with the molecular formula C7H9ClN4 and a molecular weight of 184.62 g/mol. IUPAC name: (4-azidophenyl)methanamine;hydrochloride. InChIKey: HSMIGMNCWQOMEB-UHFFFAOYSA-N.
| Molecular formula | C7H9ClN4 |
|---|---|
| Molecular weight | 184.62 g/mol |
| IUPAC name | (4-azidophenyl)methanamine;hydrochloride |
| InChIKey | HSMIGMNCWQOMEB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN)N=[N+]=[N-].Cl |
Computed by PubChem (NCBI)