Products 1803603-36-2
CAS 1803603-36-2 is the registry number for 2,4,6-Trimethyl-3-(trifluoromethyl)pyridine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2,4,6-trimethyl-3-(trifluoromethyl)pyridine (CAS 1803603-36-2) is a chemical compound with the molecular formula C9H10F3N and a molecular weight of 189.18 g/mol. IUPAC name: 2,4,6-trimethyl-3-(trifluoromethyl)pyridine. InChIKey: BEXRTTXWMKZWID-UHFFFAOYSA-N.
| Molecular formula | C9H10F3N |
|---|---|
| Molecular weight | 189.18 g/mol |
| IUPAC name | 2,4,6-trimethyl-3-(trifluoromethyl)pyridine |
| InChIKey | BEXRTTXWMKZWID-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=C1C(F)(F)F)C)C |
Computed by PubChem (NCBI)