CAS 1803603-41-9 appears in our catalog under these names: 5-Bromo-1,2-dimethyl-1H-imidazole-4-sulfonamide, 95%, 5-Bromo-1,2-dimethyl-1H-imidazole-4-sulfonamide. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
5-bromo-1,2-dimethylimidazole-4-sulfonamide (CAS 1803603-41-9) is a chemical compound with the molecular formula C5H8BrN3O2S and a molecular weight of 254.11 g/mol. IUPAC name: 5-bromo-1,2-dimethylimidazole-4-sulfonamide. InChIKey: CMLSIFHZLYVFOE-UHFFFAOYSA-N.
| Molecular formula | C5H8BrN3O2S |
|---|---|
| Molecular weight | 254.11 g/mol |
| IUPAC name | 5-bromo-1,2-dimethylimidazole-4-sulfonamide |
| InChIKey | CMLSIFHZLYVFOE-UHFFFAOYSA-N |
| SMILES | CC1=NC(=C(N1C)Br)S(=O)(=O)N |
Computed by PubChem (NCBI)