CAS 623577-41-3 is the registry number for 4-Bromo-N,N-dimethyl-1H-imidazole-1-sulfonamide, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-bromo-N,N-dimethylimidazole-1-sulfonamide (CAS 623577-41-3) is a chemical compound with the molecular formula C5H8BrN3O2S and a molecular weight of 254.11 g/mol. IUPAC name: 4-bromo-N,N-dimethylimidazole-1-sulfonamide. InChIKey: OSQXSWIBDOLLBI-UHFFFAOYSA-N.
| Molecular formula | C5H8BrN3O2S |
|---|---|
| Molecular weight | 254.11 g/mol |
| IUPAC name | 4-bromo-N,N-dimethylimidazole-1-sulfonamide |
| InChIKey | OSQXSWIBDOLLBI-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)N1C=C(N=C1)Br |
Computed by PubChem (NCBI)