CAS 1803605-48-2 appears in our catalog under these names: 1-(Methoxymethyl)-3,5-dimethyl-1H-pyrazole-4-sulfonyl chloride, 95%, 1-(Methoxymethyl)-3,5-dimethyl-1H-pyrazole-4-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1-(methoxymethyl)-3,5-dimethylpyrazole-4-sulfonyl chloride (CAS 1803605-48-2) is a chemical compound with the molecular formula C7H11ClN2O3S and a molecular weight of 238.69 g/mol. IUPAC name: 1-(methoxymethyl)-3,5-dimethylpyrazole-4-sulfonyl chloride. InChIKey: MCXIHAXBGMRYQV-UHFFFAOYSA-N.
| Molecular formula | C7H11ClN2O3S |
|---|---|
| Molecular weight | 238.69 g/mol |
| IUPAC name | 1-(methoxymethyl)-3,5-dimethylpyrazole-4-sulfonyl chloride |
| InChIKey | MCXIHAXBGMRYQV-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1COC)C)S(=O)(=O)Cl |
Computed by PubChem (NCBI)