CAS 2260935-89-3 is the registry number for 4-Amino-2-methoxybenzene-1-sulfonamide hydrochloride. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
4-amino-2-methoxybenzenesulfonamide;hydrochloride (CAS 2260935-89-3) is a chemical compound with the molecular formula C7H11ClN2O3S and a molecular weight of 238.69 g/mol. IUPAC name: 4-amino-2-methoxybenzenesulfonamide;hydrochloride. InChIKey: RUBNMNPLWGJAIT-UHFFFAOYSA-N.
| Molecular formula | C7H11ClN2O3S |
|---|---|
| Molecular weight | 238.69 g/mol |
| IUPAC name | 4-amino-2-methoxybenzenesulfonamide;hydrochloride |
| InChIKey | RUBNMNPLWGJAIT-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)N)S(=O)(=O)N.Cl |
Computed by PubChem (NCBI)