Products 1803607-08-0

CAS 1803607-08-0 is the registry number for tert-Butyl 4-(4-(cyanosulfanyl)phenyl)piperazine-1-carboxylate. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.

Structural formula: {0} (CAS {1})

Tert-butyl 4-(4-thiocyanatophenyl)piperazine-1-carboxylate (CAS 1803607-08-0) is a chemical compound with the molecular formula C16H21N3O2S and a molecular weight of 319.4 g/mol. IUPAC name: tert-butyl 4-(4-thiocyanatophenyl)piperazine-1-carboxylate. InChIKey: MWKNUMMPSCGXJR-UHFFFAOYSA-N.

Identity
Molecular formulaC16H21N3O2S
Molecular weight319.4 g/mol
IUPAC nametert-butyl 4-(4-thiocyanatophenyl)piperazine-1-carboxylate
InChIKeyMWKNUMMPSCGXJR-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCN(CC1)C2=CC=C(C=C2)SC#N

Computed by PubChem (NCBI)