CAS 1973494-16-4 is the registry number for NRL-1049, 99.96%. Offered by: MedChemExpress. Available pack sizes: 25 mg, 10 mg, 5 mg, 1 mg.
(1R)-1-(1-isoquinolin-5-ylsulfonylpiperidin-4-yl)ethanamine (CAS 1973494-16-4) is a chemical compound with the molecular formula C16H21N3O2S and a molecular weight of 319.4 g/mol. IUPAC name: (1R)-1-(1-isoquinolin-5-ylsulfonylpiperidin-4-yl)ethanamine. InChIKey: MGLIYKZFLDTAMW-GFCCVEGCSA-N.
| Molecular formula | C16H21N3O2S |
|---|---|
| Molecular weight | 319.4 g/mol |
| IUPAC name | (1R)-1-(1-isoquinolin-5-ylsulfonylpiperidin-4-yl)ethanamine |
| InChIKey | MGLIYKZFLDTAMW-GFCCVEGCSA-N |
| SMILES | C[C@H](C1CCN(CC1)S(=O)(=O)C2=CC=CC3=C2C=CN=C3)N |
Computed by PubChem (NCBI)