Products 1803609-16-6

CAS 1803609-16-6 is the registry number for 4-(Pyridin-3-yl)butanoic acid dihydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 5g, 1g.

4-pyridin-3-ylbutanoic acid;dihydrochloride (CAS 1803609-16-6) is a chemical compound with the molecular formula C9H13Cl2NO2 and a molecular weight of 238.11 g/mol. IUPAC name: 4-pyridin-3-ylbutanoic acid;dihydrochloride. InChIKey: NOOHPLDVMAAWGQ-UHFFFAOYSA-N.

Identity
Molecular formulaC9H13Cl2NO2
Molecular weight238.11 g/mol
IUPAC name4-pyridin-3-ylbutanoic acid;dihydrochloride
InChIKeyNOOHPLDVMAAWGQ-UHFFFAOYSA-N
SMILESC1=CC(=CN=C1)CCCC(=O)O.Cl.Cl

Computed by PubChem (NCBI)