CAS 2504202-01-9 appears in our catalog under these names: 2-Chloro-3,4-dimethoxybenzylamine hydrochloride, 95%, (2-Chloro-3,4-dimethoxyphenyl)methanamine hydrochloride, 98%, 2-Chloro-3,4-dimethoxybenzylamine HCl. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 100mg, 250mg, 50mg, 25mg.
(2-chloro-3,4-dimethoxyphenyl)methanamine;hydrochloride (CAS 2504202-01-9) is a chemical compound with the molecular formula C9H13Cl2NO2 and a molecular weight of 238.11 g/mol. IUPAC name: (2-chloro-3,4-dimethoxyphenyl)methanamine;hydrochloride. InChIKey: TXIKTUHBZAYFOQ-UHFFFAOYSA-N.
| Molecular formula | C9H13Cl2NO2 |
|---|---|
| Molecular weight | 238.11 g/mol |
| IUPAC name | (2-chloro-3,4-dimethoxyphenyl)methanamine;hydrochloride |
| InChIKey | TXIKTUHBZAYFOQ-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)CN)Cl)OC.Cl |
Computed by PubChem (NCBI)