Products 1803609-28-0
CAS 1803609-28-0 is the registry number for tert-Butyl N-{(3-oxo-1-(trifluoromethyl)cyclobutyl)methyl}carbamate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Tert-butyl N-[[3-oxo-1-(trifluoromethyl)cyclobutyl]methyl]carbamate (CAS 1803609-28-0) is a chemical compound with the molecular formula C11H16F3NO3 and a molecular weight of 267.24 g/mol. IUPAC name: tert-butyl N-[[3-oxo-1-(trifluoromethyl)cyclobutyl]methyl]carbamate. InChIKey: XDYXCXMMKKEGSA-UHFFFAOYSA-N.
| Molecular formula | C11H16F3NO3 |
|---|---|
| Molecular weight | 267.24 g/mol |
| IUPAC name | tert-butyl N-[[3-oxo-1-(trifluoromethyl)cyclobutyl]methyl]carbamate |
| InChIKey | XDYXCXMMKKEGSA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1(CC(=O)C1)C(F)(F)F |
Computed by PubChem (NCBI)