CAS 913979-70-1 is the registry number for (S)–tert–Butyl 2–(2,2,2–trifluoroacetyl)pyrrolidine–1–carboxylate. Offered by: GLPBio. Available pack sizes: 100mg.
Tert-butyl (2S)-2-(2,2,2-trifluoroacetyl)pyrrolidine-1-carboxylate (CAS 913979-70-1) is a chemical compound with the molecular formula C11H16F3NO3 and a molecular weight of 267.24 g/mol. IUPAC name: tert-butyl (2S)-2-(2,2,2-trifluoroacetyl)pyrrolidine-1-carboxylate. InChIKey: OPXZYCVUEJSXKH-ZETCQYMHSA-N.
| Molecular formula | C11H16F3NO3 |
|---|---|
| Molecular weight | 267.24 g/mol |
| IUPAC name | tert-butyl (2S)-2-(2,2,2-trifluoroacetyl)pyrrolidine-1-carboxylate |
| InChIKey | OPXZYCVUEJSXKH-ZETCQYMHSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1C(=O)C(F)(F)F |
Computed by PubChem (NCBI)