CAS 1803609-42-8 is the registry number for 2,2-Difluoro-2-(5-phenyl-1,3-oxazol-2-yl)ethan-1-amine, 95%. Offered by: AmBeed. Available pack sizes: 1g.
2,2-difluoro-2-(5-phenyl-1,3-oxazol-2-yl)ethanamine (CAS 1803609-42-8) is a chemical compound with the molecular formula C11H10F2N2O and a molecular weight of 224.21 g/mol. IUPAC name: 2,2-difluoro-2-(5-phenyl-1,3-oxazol-2-yl)ethanamine. InChIKey: VCNGWLWOLSPWOD-UHFFFAOYSA-N.
| Molecular formula | C11H10F2N2O |
|---|---|
| Molecular weight | 224.21 g/mol |
| IUPAC name | 2,2-difluoro-2-(5-phenyl-1,3-oxazol-2-yl)ethanamine |
| InChIKey | VCNGWLWOLSPWOD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CN=C(O2)C(CN)(F)F |
Computed by PubChem (NCBI)