CAS 2716961-69-0 is the registry number for (R)-1-(4,5-Difluoro-2-(1H-pyrazol-1-yl)phenyl)ethan-1-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R)-1-(4,5-difluoro-2-pyrazol-1-ylphenyl)ethanol (CAS 2716961-69-0) is a chemical compound with the molecular formula C11H10F2N2O and a molecular weight of 224.21 g/mol. IUPAC name: (1R)-1-(4,5-difluoro-2-pyrazol-1-ylphenyl)ethanol. InChIKey: ZGYKUIJJGCDSBE-SSDOTTSWSA-N.
| Molecular formula | C11H10F2N2O |
|---|---|
| Molecular weight | 224.21 g/mol |
| IUPAC name | (1R)-1-(4,5-difluoro-2-pyrazol-1-ylphenyl)ethanol |
| InChIKey | ZGYKUIJJGCDSBE-SSDOTTSWSA-N |
| SMILES | C[C@H](C1=CC(=C(C=C1N2C=CC=N2)F)F)O |
Computed by PubChem (NCBI)