Products 1803611-94-0
CAS 1803611-94-0 appears in our catalog under these names: 5-fluoro-6-methoxy-2,3-dihydro-1h-inden-1-amine hydrochloride, 95%, 5-Fluoro-6-methoxy-2,3-dihydro-1H-inden-1-amine hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 5g, 0,5g.
5-fluoro-6-methoxy-2,3-dihydro-1H-inden-1-amine;hydrochloride (CAS 1803611-94-0) is a chemical compound with the molecular formula C10H13ClFNO and a molecular weight of 217.67 g/mol. IUPAC name: 5-fluoro-6-methoxy-2,3-dihydro-1H-inden-1-amine;hydrochloride. InChIKey: SEGPKRGBJLIKKP-UHFFFAOYSA-N.
| Molecular formula | C10H13ClFNO |
|---|---|
| Molecular weight | 217.67 g/mol |
| IUPAC name | 5-fluoro-6-methoxy-2,3-dihydro-1H-inden-1-amine;hydrochloride |
| InChIKey | SEGPKRGBJLIKKP-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2CCC(C2=C1)N)F.Cl |
Computed by PubChem (NCBI)