CAS 2490698-25-2 appears in our catalog under these names: (7-Fluorochroman-4-yl)methanamine hydrochloride, 95%, (7-Fluorochroman-4-yl)methanamine hydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
(7-fluoro-3,4-dihydro-2H-chromen-4-yl)methanamine;hydrochloride (CAS 2490698-25-2) is a chemical compound with the molecular formula C10H13ClFNO and a molecular weight of 217.67 g/mol. IUPAC name: (7-fluoro-3,4-dihydro-2H-chromen-4-yl)methanamine;hydrochloride. InChIKey: VLSXQKOJPPYSDK-UHFFFAOYSA-N.
| Molecular formula | C10H13ClFNO |
|---|---|
| Molecular weight | 217.67 g/mol |
| IUPAC name | (7-fluoro-3,4-dihydro-2H-chromen-4-yl)methanamine;hydrochloride |
| InChIKey | VLSXQKOJPPYSDK-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C1CN)C=CC(=C2)F.Cl |
Computed by PubChem (NCBI)