Products 1803715-90-3
CAS 1803715-90-3 is the registry number for Benzene, 1,3-dibromo-4-ethoxy-2-fluoro-, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1,3-dibromo-4-ethoxy-2-fluorobenzene (CAS 1803715-90-3) is a chemical compound with the molecular formula C8H7Br2FO and a molecular weight of 297.95 g/mol. IUPAC name: 1,3-dibromo-4-ethoxy-2-fluorobenzene. InChIKey: MULCORYFGNJOHV-UHFFFAOYSA-N.
| Molecular formula | C8H7Br2FO |
|---|---|
| Molecular weight | 297.95 g/mol |
| IUPAC name | 1,3-dibromo-4-ethoxy-2-fluorobenzene |
| InChIKey | MULCORYFGNJOHV-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C(=C(C=C1)Br)F)Br |
Computed by PubChem (NCBI)