CAS 1803806-97-4 appears in our catalog under these names: 2,5-Dichloro-4-fluorobenzenesulfonamide, 95%, 2,5-Dichloro-4-fluorobenzene-1-sulfonamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 0,5g.
2,5-dichloro-4-fluorobenzenesulfonamide (CAS 1803806-97-4) is a chemical compound with the molecular formula C6H4Cl2FNO2S and a molecular weight of 244.07 g/mol. IUPAC name: 2,5-dichloro-4-fluorobenzenesulfonamide. InChIKey: CJILQZLHKHRXGK-UHFFFAOYSA-N.
| Molecular formula | C6H4Cl2FNO2S |
|---|---|
| Molecular weight | 244.07 g/mol |
| IUPAC name | 2,5-dichloro-4-fluorobenzenesulfonamide |
| InChIKey | CJILQZLHKHRXGK-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Cl)S(=O)(=O)N)Cl)F |
Computed by PubChem (NCBI)