CAS 1804514-32-6 appears in our catalog under these names: 3,6-Dichloro-2-fluorobenzenesulfonamide, 95%, 3,6-Dichloro-2-fluorobenzenesulfonamide, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g.
3,6-dichloro-2-fluorobenzenesulfonamide (CAS 1804514-32-6) is a chemical compound with the molecular formula C6H4Cl2FNO2S and a molecular weight of 244.07 g/mol. IUPAC name: 3,6-dichloro-2-fluorobenzenesulfonamide. InChIKey: RHLFBRQHYYNSME-UHFFFAOYSA-N.
| Molecular formula | C6H4Cl2FNO2S |
|---|---|
| Molecular weight | 244.07 g/mol |
| IUPAC name | 3,6-dichloro-2-fluorobenzenesulfonamide |
| InChIKey | RHLFBRQHYYNSME-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1Cl)F)S(=O)(=O)N)Cl |
Computed by PubChem (NCBI)