Products 180420-84-2
CAS 180420-84-2 is the registry number for 1-(2-Deoxy-b-D-ribofuranosyl)-4-methylindole. Offered by: Biosynth. Available pack sizes: 5mg, 2mg, 10mg, 20mg.
(2R,3S,5R)-2-(hydroxymethyl)-5-(4-methylindol-1-yl)oxolan-3-ol (CAS 180420-84-2) is a chemical compound with the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. IUPAC name: (2R,3S,5R)-2-(hydroxymethyl)-5-(4-methylindol-1-yl)oxolan-3-ol. InChIKey: CHXZVEGQPNGWDG-BFHYXJOUSA-N.
| Molecular formula | C14H17NO3 |
|---|---|
| Molecular weight | 247.29 g/mol |
| IUPAC name | (2R,3S,5R)-2-(hydroxymethyl)-5-(4-methylindol-1-yl)oxolan-3-ol |
| InChIKey | CHXZVEGQPNGWDG-BFHYXJOUSA-N |
| SMILES | CC1=C2C=CN(C2=CC=C1)[C@H]3C[C@@H]([C@H](O3)CO)O |
Computed by PubChem (NCBI)