Products 180481-87-2
CAS 180481-87-2 is the registry number for rac-(3aR,6aS)-2-Methyl-octahydrocyclopenta(C)pyrrol-4-one. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(3aS,6aR)-2-methyl-1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrol-4-one (CAS 180481-87-2) is a chemical compound with the molecular formula C8H13NO and a molecular weight of 139.19 g/mol. IUPAC name: (3aS,6aR)-2-methyl-1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrol-4-one. InChIKey: BRYHFQMDNZZHSI-NKWVEPMBSA-N.
| Molecular formula | C8H13NO |
|---|---|
| Molecular weight | 139.19 g/mol |
| IUPAC name | (3aS,6aR)-2-methyl-1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrol-4-one |
| InChIKey | BRYHFQMDNZZHSI-NKWVEPMBSA-N |
| SMILES | CN1C[C@@H]2CCC(=O)[C@@H]2C1 |
Computed by PubChem (NCBI)