CAS 1804933-11-6 appears in our catalog under these names: 1,3-Dibromo-2-(bromomethyl)-5-fluorobenzene, 95%, 1,3–Dibromo–2–(bromomethyl)–5–fluorobenzene, 1,3-Dibromo-2-(bromomethyl)-5-fluorobenzene 97%, 1,3-Dibromo-2-(bromomethyl)-5-fluorobenzene, 95%, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
1,3-dibromo-2-(bromomethyl)-5-fluorobenzene (CAS 1804933-11-6) is a chemical compound with the molecular formula C7H4Br3F and a molecular weight of 346.82 g/mol. IUPAC name: 1,3-dibromo-2-(bromomethyl)-5-fluorobenzene. InChIKey: QHTINKMUZDQXPW-UHFFFAOYSA-N.
| Molecular formula | C7H4Br3F |
|---|---|
| Molecular weight | 346.82 g/mol |
| IUPAC name | 1,3-dibromo-2-(bromomethyl)-5-fluorobenzene |
| InChIKey | QHTINKMUZDQXPW-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Br)CBr)Br)F |
Computed by PubChem (NCBI)