CAS 726185-32-6 is the registry number for 1,3-Dibromo-5-(bromomethyl)-2-fluorobenzene, 95%. Offered by: AmBeed, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
1,3-dibromo-5-(bromomethyl)-2-fluorobenzene (CAS 726185-32-6) is a chemical compound with the molecular formula C7H4Br3F and a molecular weight of 346.82 g/mol. IUPAC name: 1,3-dibromo-5-(bromomethyl)-2-fluorobenzene. InChIKey: VIGJPLLOGSYVQF-UHFFFAOYSA-N.
| Molecular formula | C7H4Br3F |
|---|---|
| Molecular weight | 346.82 g/mol |
| IUPAC name | 1,3-dibromo-5-(bromomethyl)-2-fluorobenzene |
| InChIKey | VIGJPLLOGSYVQF-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Br)F)Br)CBr |
Computed by PubChem (NCBI)